C22H30BrN3O5 — CID 70437595
(2S)-2-[[(2S)-1-[(2S)-2-[(2-bromo-3-phenylpropanoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 70437595) has the molecular formula C22H30BrN3O5 and a molecular weight of 496.40 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-[(2S)-2-[(2-bromo-3-phenylpropanoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-[(2S)-2-[(2-bromo-3-phenylpropanoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 70437595 |
| Molecular Formula | C22H30BrN3O5 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (2S)-2-[[(2S)-1-[(2S)-2-[(2-bromo-3-phenylpropanoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)C(Br)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H30BrN3O5/c1-13(2)18(22(30)31)25-20(28)17-10-7-11-26(17)21(29)14(3)24-19(27)16(23)12-15-8-5-4-6-9-15/h4-6,8-9,13-14,16-18H,7,10-12H2,1-3H3,(H,24,27)(H,25,28)(H,30,31)/t14-,16?,17-,18-/m0/s1 |
| InChIKey | KLXOPJJCPBPTTQ-NDUHQTEVSA-N |
| XLogP | 1.71 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|