C26H36N4O6 — CID 67726103
(2S)-3-methyl-2-[[(2S)-1-[(2S)-2-[[(2S)-2-(3-phenylbut-2-enoylamino)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]butanoic acid (PubChem CID 67726103) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2S)-1-[(2S)-2-[[(2S)-2-(3-phenylbut-2-enoylamino)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(2S)-1-[(2S)-2-[[(2S)-2-(3-phenylbut-2-enoylamino)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 67726103 |
| Molecular Formula | C26H36N4O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (2S)-3-methyl-2-[[(2S)-1-[(2S)-2-[[(2S)-2-(3-phenylbut-2-enoylamino)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]butanoic acid |
| SMILES | CC(=CC(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H36N4O6/c1-15(2)22(26(35)36)29-24(33)20-12-9-13-30(20)25(34)18(5)28-23(32)17(4)27-21(31)14-16(3)19-10-7-6-8-11-19/h6-8,10-11,14-15,17-18,20,22H,9,12-13H2,1-5H3,(H,27,31)(H,28,32)(H,29,33)(H,35,36)/t17-,18-,20-,22-/m0/s1 |
| InChIKey | MJIRIGHLFSMIIM-JEEBJRHZSA-N |
| XLogP | 1.32 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|