C14H24N2O5 — CID 18928254
methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 18928254) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 18928254 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O5/c1-9(15-13(19)21-14(2,3)4)11(17)16-8-6-7-10(16)12(18)20-5/h9-10H,6-8H2,1-5H3,(H,15,19) |
| InChIKey | PXUDMIKHPDTISH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |