C15H26N2O4S — CID 12968644
S-ethyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carbothioate (PubChem CID 12968644) has the molecular formula C15H26N2O4S and a molecular weight of 330.45 g/mol. Its IUPAC name is S-ethyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carbothioate.
| Compound Name | S-ethyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 12968644 |
| Molecular Formula | C15H26N2O4S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | S-ethyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carbothioate |
| SMILES | CCSC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N2O4S/c1-6-22-13(19)11-8-7-9-17(11)12(18)10(2)16-14(20)21-15(3,4)5/h10-11H,6-9H2,1-5H3,(H,16,20)/t10-,11-/m0/s1 |
| InChIKey | MSLQFKWVUAALLB-QWRGUYRKSA-N |
| XLogP | 2.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|