C24H29O2PSi — CID 102599598
(2S,3S)-3-[dimethyl(phenyl)silyl]-4-diphenylphosphorylbutan-2-ol (PubChem CID 102599598) has the molecular formula C24H29O2PSi and a molecular weight of 408.55 g/mol. Its IUPAC name is (2S,3S)-3-[dimethyl(phenyl)silyl]-4-diphenylphosphorylbutan-2-ol.
| Compound Name | (2S,3S)-3-[dimethyl(phenyl)silyl]-4-diphenylphosphorylbutan-2-ol |
|---|---|
| PubChem CID | 102599598 |
| Molecular Formula | C24H29O2PSi |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (2S,3S)-3-[dimethyl(phenyl)silyl]-4-diphenylphosphorylbutan-2-ol |
| SMILES | C[C@H](O)[C@@H](CP(=O)(c1ccccc1)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H29O2PSi/c1-20(25)24(28(2,3)23-17-11-6-12-18-23)19-27(26,21-13-7-4-8-14-21)22-15-9-5-10-16-22/h4-18,20,24-25H,19H2,1-3H3/t20-,24+/m0/s1 |
| InChIKey | FVIKABPDYJGTHR-GBXCKJPGSA-N |
| XLogP | 4.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|