C19H24O3Si — CID 99773408
(2R,3R)-2-[(S)-[dimethyl(phenyl)silyl]-phenylmethyl]-3-hydroxybutanoic acid (PubChem CID 99773408) has the molecular formula C19H24O3Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (2R,3R)-2-[(S)-[dimethyl(phenyl)silyl]-phenylmethyl]-3-hydroxybutanoic acid.
| Compound Name | (2R,3R)-2-[(S)-[dimethyl(phenyl)silyl]-phenylmethyl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 99773408 |
| Molecular Formula | C19H24O3Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2R,3R)-2-[(S)-[dimethyl(phenyl)silyl]-phenylmethyl]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](C(=O)O)[C@@H](c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H24O3Si/c1-14(20)17(19(21)22)18(15-10-6-4-7-11-15)23(2,3)16-12-8-5-9-13-16/h4-14,17-18,20H,1-3H3,(H,21,22)/t14-,17+,18-/m1/s1 |
| InChIKey | FWSPPXISTPEPSH-FHLIZLRMSA-N |
| XLogP | 3.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|