C18H21FO2Si — CID 11255556
(2S,3S)-3-[dimethyl(phenyl)silyl]-3-(4-fluorophenyl)-2-methylpropanoic acid (PubChem CID 11255556) has the molecular formula C18H21FO2Si and a molecular weight of 316.45 g/mol. Its IUPAC name is (2S,3S)-3-[dimethyl(phenyl)silyl]-3-(4-fluorophenyl)-2-methylpropanoic acid.
| Compound Name | (2S,3S)-3-[dimethyl(phenyl)silyl]-3-(4-fluorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11255556 |
| Molecular Formula | C18H21FO2Si |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2S,3S)-3-[dimethyl(phenyl)silyl]-3-(4-fluorophenyl)-2-methylpropanoic acid |
| SMILES | C[C@@H](C(=O)O)[C@@H](c1ccc(F)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H21FO2Si/c1-13(18(20)21)17(14-9-11-15(19)12-10-14)22(2,3)16-7-5-4-6-8-16/h4-13,17H,1-3H3,(H,20,21)/t13-,17+/m1/s1 |
| InChIKey | COEFKYHYMKUEEJ-DYVFJYSZSA-N |
| XLogP | 3.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|