C29H28O2Si — CID 154721488
[(1R,2S)-2-[dimethyl(phenyl)silyl]-1,2-diphenylethyl] benzoate (PubChem CID 154721488) has the molecular formula C29H28O2Si and a molecular weight of 436.63 g/mol. Its IUPAC name is [(1R,2S)-2-[dimethyl(phenyl)silyl]-1,2-diphenylethyl] benzoate.
| Compound Name | [(1R,2S)-2-[dimethyl(phenyl)silyl]-1,2-diphenylethyl] benzoate |
|---|---|
| PubChem CID | 154721488 |
| Molecular Formula | C29H28O2Si |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | [(1R,2S)-2-[dimethyl(phenyl)silyl]-1,2-diphenylethyl] benzoate |
| SMILES | C[Si](C)(c1ccccc1)[C@@H](c1ccccc1)[C@H](OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28O2Si/c1-32(2,26-21-13-6-14-22-26)28(24-17-9-4-10-18-24)27(23-15-7-3-8-16-23)31-29(30)25-19-11-5-12-20-25/h3-22,27-28H,1-2H3/t27-,28+/m1/s1 |
| InChIKey | KQQKQVNPQNZSJB-IZLXSDGUSA-N |
| XLogP | 6.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|