About [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate
[(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate (PubChem CID 102588067) has the molecular formula C24H25ClO2Si
and a molecular weight of 409.00 g/mol. Its IUPAC name is [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate.
Molecular Properties
| Compound Name | [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate |
| PubChem CID | 102588067 |
| Molecular Formula | C24H25ClO2Si |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate |
| SMILES | C[C@@H](C(OC(=O)c1cccc(Cl)c1)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H25ClO2Si/c1-18(28(2,3)22-15-8-5-9-16-22)23(19-11-6-4-7-12-19)27-24(26)20-13-10-14-21(25)17-20/h4-18,23H,1-3H3/t18-,23?/m0/s1 |
| InChIKey | VQQSVLAYRWCHJK-XNUZUHMRSA-N |
| XLogP | 6.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate?
The IUPAC name of [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate (CID 102588067) is [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate.
What is the SMILES notation for [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate?
The canonical SMILES for [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate is C[C@@H](C(OC(=O)c1cccc(Cl)c1)c1ccccc1)[Si](C)(C)c1ccccc1.
What is the InChIKey of [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate?
The InChIKey is VQQSVLAYRWCHJK-XNUZUHMRSA-N. The full InChI is InChI=1S/C24H25ClO2Si/c1-18(28(2,3)22-15-8-5-9-16-22)23(19-11-6-4-7-12-19)27-24(26)20-13-10-14-21(25)17-20/h4-18,23H,1-3H3/t18-,23?/m0/s1.
What are the key properties of [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate?
[(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate has a molecular weight of 409.00 g/mol, XLogP of 6.24, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-[dimethyl(phenyl)silyl]-1-phenylpropyl] 3-chlorobenzoate is sourced from PubChem (CID 102588067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).