C27H27NSi — CID 170555113
(1,2-diphenyl-2-pyridin-4-ylethyl)-dimethyl-phenylsilane (PubChem CID 170555113) has the molecular formula C27H27NSi and a molecular weight of 393.61 g/mol. Its IUPAC name is (1,2-diphenyl-2-pyridin-4-ylethyl)-dimethyl-phenylsilane.
| Compound Name | (1,2-diphenyl-2-pyridin-4-ylethyl)-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 170555113 |
| Molecular Formula | C27H27NSi |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (1,2-diphenyl-2-pyridin-4-ylethyl)-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)C(c1ccccc1)C(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C27H27NSi/c1-29(2,25-16-10-5-11-17-25)27(24-14-8-4-9-15-24)26(22-12-6-3-7-13-22)23-18-20-28-21-19-23/h3-21,26-27H,1-2H3 |
| InChIKey | AXLFYPISBPESQR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|