C16H16O2 — CID 91337190
3-hydroxy-1,1-diphenylbutan-2-one (PubChem CID 91337190) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 3-hydroxy-1,1-diphenylbutan-2-one.
| Compound Name | 3-hydroxy-1,1-diphenylbutan-2-one |
|---|---|
| PubChem CID | 91337190 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 3-hydroxy-1,1-diphenylbutan-2-one |
| SMILES | CC(O)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O2/c1-12(17)16(18)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15,17H,1H3 |
| InChIKey | LYCNOYFIDLROMH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |