C18H19NO2 — CID 162242633
(2R)-2-methyl-4-oxo-5,5-diphenylpentanamide (PubChem CID 162242633) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (2R)-2-methyl-4-oxo-5,5-diphenylpentanamide.
| Compound Name | (2R)-2-methyl-4-oxo-5,5-diphenylpentanamide |
|---|---|
| PubChem CID | 162242633 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2R)-2-methyl-4-oxo-5,5-diphenylpentanamide |
| SMILES | C[C@H](CC(=O)C(c1ccccc1)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C18H19NO2/c1-13(18(19)21)12-16(20)17(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,13,17H,12H2,1H3,(H2,19,21)/t13-/m1/s1 |
| InChIKey | VRCZKRYFOQNSHC-CYBMUJFWSA-N |
| XLogP | 2.90 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |