C19H20O2 — CID 159281542
(4R)-4-methyl-1,1-diphenylhexane-2,5-dione (PubChem CID 159281542) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (4R)-4-methyl-1,1-diphenylhexane-2,5-dione.
| Compound Name | (4R)-4-methyl-1,1-diphenylhexane-2,5-dione |
|---|---|
| PubChem CID | 159281542 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (4R)-4-methyl-1,1-diphenylhexane-2,5-dione |
| SMILES | CC(=O)[C@H](C)CC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O2/c1-14(15(2)20)13-18(21)19(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,14,19H,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | AXYHPMIKXSTBRX-CQSZACIVSA-N |
| XLogP | 4.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |