C12H16O3 — CID 139089580
(1R,4S)-1,5-dihydroxy-4-methyl-1-phenylpentan-3-one (PubChem CID 139089580) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (1R,4S)-1,5-dihydroxy-4-methyl-1-phenylpentan-3-one.
| Compound Name | (1R,4S)-1,5-dihydroxy-4-methyl-1-phenylpentan-3-one |
|---|---|
| PubChem CID | 139089580 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (1R,4S)-1,5-dihydroxy-4-methyl-1-phenylpentan-3-one |
| SMILES | C[C@@H](CO)C(=O)C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H16O3/c1-9(8-13)11(14)7-12(15)10-5-3-2-4-6-10/h2-6,9,12-13,15H,7-8H2,1H3/t9-,12+/m0/s1 |
| InChIKey | POTVZQBETZFFRB-JOYOIKCWSA-N |
| XLogP | 1.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |