C13H18O2 — CID 131864107
(1R,4R)-1-hydroxy-4-methyl-1-phenylhexan-3-one (PubChem CID 131864107) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is (1R,4R)-1-hydroxy-4-methyl-1-phenylhexan-3-one.
| Compound Name | (1R,4R)-1-hydroxy-4-methyl-1-phenylhexan-3-one |
|---|---|
| PubChem CID | 131864107 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1R,4R)-1-hydroxy-4-methyl-1-phenylhexan-3-one |
| SMILES | CC[C@@H](C)C(=O)C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-3-10(2)12(14)9-13(15)11-7-5-4-6-8-11/h4-8,10,13,15H,3,9H2,1-2H3/t10-,13-/m1/s1 |
| InChIKey | MVNLSTIMRDIEFO-ZWNOBZJWSA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |