C13H21NO2 — CID 143411629
ethane;N-ethyl-3-hydroxy-3-phenylpropanamide (PubChem CID 143411629) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is ethane;N-ethyl-3-hydroxy-3-phenylpropanamide.
| Compound Name | ethane;N-ethyl-3-hydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 143411629 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | ethane;N-ethyl-3-hydroxy-3-phenylpropanamide |
| SMILES | CC.CCNC(=O)CC(O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO2.C2H6/c1-2-12-11(14)8-10(13)9-6-4-3-5-7-9;1-2/h3-7,10,13H,2,8H2,1H3,(H,12,14);1-2H3 |
| InChIKey | OQUFAEUXCIWOHJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |