C23H32O6S2 — CID 87494521
bis(4-phenyl-4-sulfanylbutanoic acid);propane-1,2-diol (PubChem CID 87494521) has the molecular formula C23H32O6S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is bis(4-phenyl-4-sulfanylbutanoic acid);propane-1,2-diol.
| Compound Name | bis(4-phenyl-4-sulfanylbutanoic acid);propane-1,2-diol |
|---|---|
| PubChem CID | 87494521 |
| Molecular Formula | C23H32O6S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | bis(4-phenyl-4-sulfanylbutanoic acid);propane-1,2-diol |
| SMILES | CC(O)CO.O=C(O)CCC(S)c1ccccc1.O=C(O)CCC(S)c1ccccc1 |
| InChI | InChI=1S/2C10H12O2S.C3H8O2/c2*11-10(12)7-6-9(13)8-4-2-1-3-5-8;1-3(5)2-4/h2*1-5,9,13H,6-7H2,(H,11,12);3-5H,2H2,1H3 |
| InChIKey | WDBGIZFUNGQWJU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|