C25H41O3PSi2 — CID 10695952
[(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane (PubChem CID 10695952) has the molecular formula C25H41O3PSi2 and a molecular weight of 476.75 g/mol. Its IUPAC name is [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane.
| Compound Name | [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10695952 |
| Molecular Formula | C25H41O3PSi2 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane |
| SMILES | CCCC[C@@H](O[Si](C)(C)C)[C@@H](CP(=O)(c1ccccc1)c1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C25H41O3PSi2/c1-8-9-20-24(27-30(2,3)4)25(28-31(5,6)7)21-29(26,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h10-19,24-25H,8-9,20-21H2,1-7H3/t24-,25-/m1/s1 |
| InChIKey | HLXNZHKBFKIDID-JWQCQUIFSA-N |
| XLogP | 6.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|