About [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane
[(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane (PubChem CID 10695952) has the molecular formula C25H41O3PSi2
and a molecular weight of 476.75 g/mol. Its IUPAC name is [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane |
| PubChem CID | 10695952 |
| Molecular Formula | C25H41O3PSi2 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane |
| SMILES | CCCC[C@@H](O[Si](C)(C)C)[C@@H](CP(=O)(c1ccccc1)c1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C25H41O3PSi2/c1-8-9-20-24(27-30(2,3)4)25(28-31(5,6)7)21-29(26,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h10-19,24-25H,8-9,20-21H2,1-7H3/t24-,25-/m1/s1 |
| InChIKey | HLXNZHKBFKIDID-JWQCQUIFSA-N |
| XLogP | 6.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane?
The IUPAC name of [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane (CID 10695952) is [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane.
What is the SMILES notation for [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane?
The canonical SMILES for [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane is CCCC[C@@H](O[Si](C)(C)C)[C@@H](CP(=O)(c1ccccc1)c1ccccc1)O[Si](C)(C)C.
What is the InChIKey of [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane?
The InChIKey is HLXNZHKBFKIDID-JWQCQUIFSA-N. The full InChI is InChI=1S/C25H41O3PSi2/c1-8-9-20-24(27-30(2,3)4)25(28-31(5,6)7)21-29(26,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h10-19,24-25H,8-9,20-21H2,1-7H3/t24-,25-/m1/s1.
What are the key properties of [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane?
[(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane has a molecular weight of 476.75 g/mol, XLogP of 6.63, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-1-diphenylphosphoryl-2-trimethylsilyloxyheptan-3-yl]oxy-trimethylsilane is sourced from PubChem (CID 10695952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).