C23H31O3P — CID 10667873
[(4S,5R)-5-(diphenylphosphorylmethyl)octan-4-yl] acetate (PubChem CID 10667873) has the molecular formula C23H31O3P and a molecular weight of 386.47 g/mol. Its IUPAC name is [(4S,5R)-5-(diphenylphosphorylmethyl)octan-4-yl] acetate.
| Compound Name | [(4S,5R)-5-(diphenylphosphorylmethyl)octan-4-yl] acetate |
|---|---|
| PubChem CID | 10667873 |
| Molecular Formula | C23H31O3P |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | [(4S,5R)-5-(diphenylphosphorylmethyl)octan-4-yl] acetate |
| SMILES | CCC[C@@H](CP(=O)(c1ccccc1)c1ccccc1)[C@H](CCC)OC(C)=O |
| InChI | InChI=1S/C23H31O3P/c1-4-12-20(23(13-5-2)26-19(3)24)18-27(25,21-14-8-6-9-15-21)22-16-10-7-11-17-22/h6-11,14-17,20,23H,4-5,12-13,18H2,1-3H3/t20-,23-/m0/s1 |
| InChIKey | AOLPMZWELPWBCC-REWPJTCUSA-N |
| XLogP | 5.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|