C26H24NO2P — CID 175087206
N-(2-diphenylphosphoryl-1-naphthalen-1-ylethyl)acetamide (PubChem CID 175087206) has the molecular formula C26H24NO2P and a molecular weight of 413.46 g/mol. Its IUPAC name is N-(2-diphenylphosphoryl-1-naphthalen-1-ylethyl)acetamide.
| Compound Name | N-(2-diphenylphosphoryl-1-naphthalen-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 175087206 |
| Molecular Formula | C26H24NO2P |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-(2-diphenylphosphoryl-1-naphthalen-1-ylethyl)acetamide |
| SMILES | CC(=O)NC(CP(=O)(c1ccccc1)c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H24NO2P/c1-20(28)27-26(25-18-10-12-21-11-8-9-17-24(21)25)19-30(29,22-13-4-2-5-14-22)23-15-6-3-7-16-23/h2-18,26H,19H2,1H3,(H,27,28) |
| InChIKey | OZBSUMSMTQHPBK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|