C15H12F3NO3 — CID 3764471
3-naphthalen-1-yl-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid (PubChem CID 3764471) has the molecular formula C15H12F3NO3 and a molecular weight of 311.26 g/mol. Its IUPAC name is 3-naphthalen-1-yl-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid.
| Compound Name | 3-naphthalen-1-yl-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 3764471 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 3-naphthalen-1-yl-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C(F)(F)F)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H12F3NO3/c16-15(17,18)14(22)19-12(8-13(20)21)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12H,8H2,(H,19,22)(H,20,21) |
| InChIKey | OBZYGVHHXAUOGT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |