About 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid
3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid (PubChem CID 2766043) has the molecular formula C11H9BrF3NO3
and a molecular weight of 340.09 g/mol. Its IUPAC name is 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid |
| PubChem CID | 2766043 |
| Molecular Formula | C11H9BrF3NO3 |
| Molecular Weight | 340.09 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)NC(=O)C(F)(F)F)Br |
| InChI | InChI=1S/C11H9BrF3NO3/c12-7-3-1-6(2-4-7)8(5-9(17)18)16-10(19)11(13,14)15/h1-4,8H,5H2,(H,16,19)(H,17,18) |
| InChIKey | PIQSBWMNNDGWPH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 341 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.09 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid?
The IUPAC name of 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid (CID 2766043) is 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid.
What is the SMILES notation for 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid?
The canonical SMILES for 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid is C1=CC(=CC=C1C(CC(=O)O)NC(=O)C(F)(F)F)Br.
What is the InChIKey of 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid?
The InChIKey is PIQSBWMNNDGWPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrF3NO3/c12-7-3-1-6(2-4-7)8(5-9(17)18)16-10(19)11(13,14)15/h1-4,8H,5H2,(H,16,19)(H,17,18).
What are the key properties of 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid?
3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid has a molecular weight of 340.09 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic Acid is sourced from PubChem (CID 2766043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).