C11H9BrF3NO3 — CID 2766043
3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid (PubChem CID 2766043) has the molecular formula C11H9BrF3NO3 and a molecular weight of 340.10 g/mol. Its IUPAC name is 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid.
| Compound Name | 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 2766043 |
| Molecular Formula | C11H9BrF3NO3 |
| Molecular Weight | 340.10 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 3-(4-bromophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H9BrF3NO3/c12-7-3-1-6(2-4-7)8(5-9(17)18)16-10(19)11(13,14)15/h1-4,8H,5H2,(H,16,19)(H,17,18) |
| InChIKey | PIQSBWMNNDGWPH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.10 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |