C14H15F3NO3- — CID 7009520
(3S)-3-(4-propan-2-ylphenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 7009520) has the molecular formula C14H15F3NO3- and a molecular weight of 302.27 g/mol. Its IUPAC name is (3S)-3-(4-propan-2-ylphenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | (3S)-3-(4-propan-2-ylphenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 7009520 |
| Molecular Formula | C14H15F3NO3- |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (3S)-3-(4-propan-2-ylphenyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | CC(C)c1ccc([C@H](CC(=O)[O-])NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3NO3/c1-8(2)9-3-5-10(6-4-9)11(7-12(19)20)18-13(21)14(15,16)17/h3-6,8,11H,7H2,1-2H3,(H,18,21)(H,19,20)/p-1/t11-/m0/s1 |
| InChIKey | USXCOSPARFHTLV-NSHDSACASA-M |
| XLogP | 1.67 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |