C15H19ClNO3- — CID 7096784
(3R)-3-(3-chloropropanoylamino)-3-(4-propan-2-ylphenyl)propanoate (PubChem CID 7096784) has the molecular formula C15H19ClNO3- and a molecular weight of 296.77 g/mol. Its IUPAC name is (3R)-3-(3-chloropropanoylamino)-3-(4-propan-2-ylphenyl)propanoate.
| Compound Name | (3R)-3-(3-chloropropanoylamino)-3-(4-propan-2-ylphenyl)propanoate |
|---|---|
| PubChem CID | 7096784 |
| Molecular Formula | C15H19ClNO3- |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (3R)-3-(3-chloropropanoylamino)-3-(4-propan-2-ylphenyl)propanoate |
| SMILES | CC(C)c1ccc([C@@H](CC(=O)[O-])NC(=O)CCCl)cc1 |
| InChI | InChI=1S/C15H20ClNO3/c1-10(2)11-3-5-12(6-4-11)13(9-15(19)20)17-14(18)7-8-16/h3-6,10,13H,7-9H2,1-2H3,(H,17,18)(H,19,20)/p-1/t13-/m1/s1 |
| InChIKey | VTRVCCYSGMZYNV-CYBMUJFWSA-M |
| XLogP | 1.74 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|