C12H11F4NO3 — CID 103804023
3-phenyl-3-(2,2,3,3-tetrafluoropropanoylamino)propanoic acid (PubChem CID 103804023) has the molecular formula C12H11F4NO3 and a molecular weight of 293.22 g/mol. Its IUPAC name is 3-phenyl-3-(2,2,3,3-tetrafluoropropanoylamino)propanoic acid.
| Compound Name | 3-phenyl-3-(2,2,3,3-tetrafluoropropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 103804023 |
| Molecular Formula | C12H11F4NO3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-phenyl-3-(2,2,3,3-tetrafluoropropanoylamino)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H11F4NO3/c13-10(14)12(15,16)11(20)17-8(6-9(18)19)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,17,20)(H,18,19) |
| InChIKey | WSHMCJFXWYOSRW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|