C15H11F3O2 — CID 174295450
1,1,1-trifluoro-3-naphthalen-1-ylpentane-2,4-dione (PubChem CID 174295450) has the molecular formula C15H11F3O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-naphthalen-1-ylpentane-2,4-dione.
| Compound Name | 1,1,1-trifluoro-3-naphthalen-1-ylpentane-2,4-dione |
|---|---|
| PubChem CID | 174295450 |
| Molecular Formula | C15H11F3O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1,1,1-trifluoro-3-naphthalen-1-ylpentane-2,4-dione |
| SMILES | CC(=O)C(C(=O)C(F)(F)F)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H11F3O2/c1-9(19)13(14(20)15(16,17)18)12-8-4-6-10-5-2-3-7-11(10)12/h2-8,13H,1H3 |
| InChIKey | KGJXAKLCSOPLIR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|