About azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate
azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate (PubChem CID 174992561) has the molecular formula C13H14F3NO3S
and a molecular weight of 321.32 g/mol. Its IUPAC name is azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate |
| PubChem CID | 174992561 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate |
| SMILES | CC(OS(=O)(=O)C(F)(F)F)c1cccc2ccccc12.N |
| InChI | InChI=1S/C13H11F3O3S.H3N/c1-9(19-20(17,18)13(14,15)16)11-8-4-6-10-5-2-3-7-12(10)11;/h2-9H,1H3;1H3 |
| InChIKey | UXPGKIWZMDSGJT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate?
The IUPAC name of azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate (CID 174992561) is azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate.
What is the SMILES notation for azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate?
The canonical SMILES for azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate is CC(OS(=O)(=O)C(F)(F)F)c1cccc2ccccc12.N.
What is the InChIKey of azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate?
The InChIKey is UXPGKIWZMDSGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3O3S.H3N/c1-9(19-20(17,18)13(14,15)16)11-8-4-6-10-5-2-3-7-12(10)11;/h2-9H,1H3;1H3.
What are the key properties of azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate?
azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate has a molecular weight of 321.32 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-naphthalen-1-ylethyl trifluoromethanesulfonate is sourced from PubChem (CID 174992561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).