C27H24F3N2O3PS — CID 155293988
[1,3-bis[(1R)-1-naphthalen-1-ylethyl]-1,3,2-diazaphosphol-2-yl] trifluoromethanesulfonate (PubChem CID 155293988) has the molecular formula C27H24F3N2O3PS and a molecular weight of 544.54 g/mol. Its IUPAC name is [1,3-bis[(1R)-1-naphthalen-1-ylethyl]-1,3,2-diazaphosphol-2-yl] trifluoromethanesulfonate.
| Compound Name | [1,3-bis[(1R)-1-naphthalen-1-ylethyl]-1,3,2-diazaphosphol-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155293988 |
| Molecular Formula | C27H24F3N2O3PS |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | [1,3-bis[(1R)-1-naphthalen-1-ylethyl]-1,3,2-diazaphosphol-2-yl] trifluoromethanesulfonate |
| SMILES | C[C@H](c1cccc2ccccc12)N1C=CN([C@H](C)c2cccc3ccccc23)P1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C27H24F3N2O3PS/c1-19(23-15-7-11-21-9-3-5-13-25(21)23)31-17-18-32(36(31)35-37(33,34)27(28,29)30)20(2)24-16-8-12-22-10-4-6-14-26(22)24/h3-20H,1-2H3/t19-,20-/m1/s1 |
| InChIKey | UUCUJUBCWMORNQ-WOJBJXKFSA-N |
| XLogP | 8.00 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|