C15H12ClNOS — CID 15987293
5-chloro-2-(1-naphthalen-1-ylethyl)-1,2-thiazol-3-one (PubChem CID 15987293) has the molecular formula C15H12ClNOS and a molecular weight of 289.79 g/mol. Its IUPAC name is 5-chloro-2-(1-naphthalen-1-ylethyl)-1,2-thiazol-3-one.
| Compound Name | 5-chloro-2-(1-naphthalen-1-ylethyl)-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 15987293 |
| Molecular Formula | C15H12ClNOS |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-chloro-2-(1-naphthalen-1-ylethyl)-1,2-thiazol-3-one |
| SMILES | CC(c1cccc2ccccc12)n1sc(Cl)cc1=O |
| InChI | InChI=1S/C15H12ClNOS/c1-10(17-15(18)9-14(16)19-17)12-8-4-6-11-5-2-3-7-13(11)12/h2-10H,1H3 |
| InChIKey | DSEKFELPFGSGBP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |