C10H12O2S — CID 100919627
(2R,3R)-3-hydroxy-2-phenylsulfanylbutanal (PubChem CID 100919627) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-2-phenylsulfanylbutanal.
| Compound Name | (2R,3R)-3-hydroxy-2-phenylsulfanylbutanal |
|---|---|
| PubChem CID | 100919627 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (2R,3R)-3-hydroxy-2-phenylsulfanylbutanal |
| SMILES | C[C@@H](O)[C@H](C=O)Sc1ccccc1 |
| InChI | InChI=1S/C10H12O2S/c1-8(12)10(7-11)13-9-5-3-2-4-6-9/h2-8,10,12H,1H3/t8-,10+/m1/s1 |
| InChIKey | KFMRNHHXBUVLEL-SCZZXKLOSA-N |
| XLogP | 1.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|