C10H14O3S — CID 54001701
3-phenylsulfanylbutane-1,2,4-triol (PubChem CID 54001701) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-phenylsulfanylbutane-1,2,4-triol.
| Compound Name | 3-phenylsulfanylbutane-1,2,4-triol |
|---|---|
| PubChem CID | 54001701 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-phenylsulfanylbutane-1,2,4-triol |
| SMILES | OCC(O)C(CO)Sc1ccccc1 |
| InChI | InChI=1S/C10H14O3S/c11-6-9(13)10(7-12)14-8-4-2-1-3-5-8/h1-5,9-13H,6-7H2 |
| InChIKey | ALJOILQOWJILAH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |