C15H26O2SSi — CID 10891872
(2S,3R)-2-phenylsulfanyl-1-trimethylsilyloxyhexan-3-ol (PubChem CID 10891872) has the molecular formula C15H26O2SSi and a molecular weight of 298.52 g/mol. Its IUPAC name is (2S,3R)-2-phenylsulfanyl-1-trimethylsilyloxyhexan-3-ol.
| Compound Name | (2S,3R)-2-phenylsulfanyl-1-trimethylsilyloxyhexan-3-ol |
|---|---|
| PubChem CID | 10891872 |
| Molecular Formula | C15H26O2SSi |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2S,3R)-2-phenylsulfanyl-1-trimethylsilyloxyhexan-3-ol |
| SMILES | CCC[C@@H](O)[C@H](CO[Si](C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C15H26O2SSi/c1-5-9-14(16)15(12-17-19(2,3)4)18-13-10-7-6-8-11-13/h6-8,10-11,14-16H,5,9,12H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | IJRVDQDRHZPZOD-CABCVRRESA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|