C18H26OS — CID 101124003
(4S,5R)-5-phenylsulfanyldodec-7-yn-4-ol (PubChem CID 101124003) has the molecular formula C18H26OS and a molecular weight of 290.47 g/mol. Its IUPAC name is (4S,5R)-5-phenylsulfanyldodec-7-yn-4-ol.
| Compound Name | (4S,5R)-5-phenylsulfanyldodec-7-yn-4-ol |
|---|---|
| PubChem CID | 101124003 |
| Molecular Formula | C18H26OS |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (4S,5R)-5-phenylsulfanyldodec-7-yn-4-ol |
| SMILES | CCCCC#CC[C@@H](Sc1ccccc1)[C@@H](O)CCC |
| InChI | InChI=1S/C18H26OS/c1-3-5-6-7-11-15-18(17(19)12-4-2)20-16-13-9-8-10-14-16/h8-10,13-14,17-19H,3-6,12,15H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | QHTKWAYSGMBXNQ-ZWKOTPCHSA-N |
| XLogP | 4.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|