C22H27NS — CID 134959711
(1S,2S)-N,N-dimethyl-1-phenyl-1-phenylsulfanyloct-3-yn-2-amine (PubChem CID 134959711) has the molecular formula C22H27NS and a molecular weight of 337.53 g/mol. Its IUPAC name is (1S,2S)-N,N-dimethyl-1-phenyl-1-phenylsulfanyloct-3-yn-2-amine.
| Compound Name | (1S,2S)-N,N-dimethyl-1-phenyl-1-phenylsulfanyloct-3-yn-2-amine |
|---|---|
| PubChem CID | 134959711 |
| Molecular Formula | C22H27NS |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (1S,2S)-N,N-dimethyl-1-phenyl-1-phenylsulfanyloct-3-yn-2-amine |
| SMILES | CCCCC#C[C@@H]([C@@H](Sc1ccccc1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C22H27NS/c1-4-5-6-13-18-21(23(2)3)22(19-14-9-7-10-15-19)24-20-16-11-8-12-17-20/h7-12,14-17,21-22H,4-6H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | DIFYMMQKAUSEEW-VXKWHMMOSA-N |
| XLogP | 5.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|