C27H30NOP — CID 132581027
N-diphenylphosphoryl-1-phenylnon-2-yn-1-amine (PubChem CID 132581027) has the molecular formula C27H30NOP and a molecular weight of 415.52 g/mol. Its IUPAC name is N-diphenylphosphoryl-1-phenylnon-2-yn-1-amine.
| Compound Name | N-diphenylphosphoryl-1-phenylnon-2-yn-1-amine |
|---|---|
| PubChem CID | 132581027 |
| Molecular Formula | C27H30NOP |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-diphenylphosphoryl-1-phenylnon-2-yn-1-amine |
| SMILES | CCCCCCC#CC(NP(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30NOP/c1-2-3-4-5-6-16-23-27(24-17-10-7-11-18-24)28-30(29,25-19-12-8-13-20-25)26-21-14-9-15-22-26/h7-15,17-22,27H,2-6H2,1H3,(H,28,29) |
| InChIKey | QMMPDOSRWDDWMR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|