C16H18Cl3NO2 — CID 102299157
2,2,2-trichloroethyl N-(1-phenylhept-2-ynyl)carbamate (PubChem CID 102299157) has the molecular formula C16H18Cl3NO2 and a molecular weight of 362.68 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(1-phenylhept-2-ynyl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(1-phenylhept-2-ynyl)carbamate |
|---|---|
| PubChem CID | 102299157 |
| Molecular Formula | C16H18Cl3NO2 |
| Molecular Weight | 362.68 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2,2,2-trichloroethyl N-(1-phenylhept-2-ynyl)carbamate |
| SMILES | CCCCC#CC(NC(=O)OCC(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C16H18Cl3NO2/c1-2-3-4-8-11-14(13-9-6-5-7-10-13)20-15(21)22-12-16(17,18)19/h5-7,9-10,14H,2-4,12H2,1H3,(H,20,21) |
| InChIKey | OBWDNSWOGVKJQL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|