C19H27NO3 — CID 11449939
tert-butyl N-(1-phenyloct-3-yn-2-yloxy)carbamate (PubChem CID 11449939) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl N-(1-phenyloct-3-yn-2-yloxy)carbamate.
| Compound Name | tert-butyl N-(1-phenyloct-3-yn-2-yloxy)carbamate |
|---|---|
| PubChem CID | 11449939 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | tert-butyl N-(1-phenyloct-3-yn-2-yloxy)carbamate |
| SMILES | CCCCC#CC(Cc1ccccc1)ONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO3/c1-5-6-7-11-14-17(15-16-12-9-8-10-13-16)23-20-18(21)22-19(2,3)4/h8-10,12-13,17H,5-7,15H2,1-4H3,(H,20,21) |
| InChIKey | YZISWYVSPFXJCB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|