C22H37NO3 — CID 174995106
tert-butyl N-(3-butyl-3-hydroxy-1-phenylheptan-2-yl)carbamate (PubChem CID 174995106) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is tert-butyl N-(3-butyl-3-hydroxy-1-phenylheptan-2-yl)carbamate.
| Compound Name | tert-butyl N-(3-butyl-3-hydroxy-1-phenylheptan-2-yl)carbamate |
|---|---|
| PubChem CID | 174995106 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | tert-butyl N-(3-butyl-3-hydroxy-1-phenylheptan-2-yl)carbamate |
| SMILES | CCCCC(O)(CCCC)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37NO3/c1-6-8-15-22(25,16-9-7-2)19(17-18-13-11-10-12-14-18)23-20(24)26-21(3,4)5/h10-14,19,25H,6-9,15-17H2,1-5H3,(H,23,24) |
| InChIKey | OHXUCMCELBEOQC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |