C24H35NO4 — CID 102046918
2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-7-yn-6-yl benzoate (PubChem CID 102046918) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-7-yn-6-yl benzoate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-7-yn-6-yl benzoate |
|---|---|
| PubChem CID | 102046918 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-7-yn-6-yl benzoate |
| SMILES | CCCCC#CC(CCCC(C)NC(=O)OC(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H35NO4/c1-6-7-8-12-17-21(28-22(26)20-15-10-9-11-16-20)18-13-14-19(2)25-23(27)29-24(3,4)5/h9-11,15-16,19,21H,6-8,13-14,18H2,1-5H3,(H,25,27) |
| InChIKey | OPYAPVHJKRPPBN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|