C21H35NO4 — CID 145115289
[(2S)-hexan-2-yl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;toluene (PubChem CID 145115289) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is [(2S)-hexan-2-yl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;toluene.
| Compound Name | [(2S)-hexan-2-yl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;toluene |
|---|---|
| PubChem CID | 145115289 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | [(2S)-hexan-2-yl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;toluene |
| SMILES | CCCC[C@H](C)OC(=O)[C@H](C)NC(=O)OC(C)(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C14H27NO4.C7H8/c1-7-8-9-10(2)18-12(16)11(3)15-13(17)19-14(4,5)6;1-7-5-3-2-4-6-7/h10-11H,7-9H2,1-6H3,(H,15,17);2-6H,1H3/t10-,11-;/m0./s1 |
| InChIKey | PRBPFLYQKOUFMN-ACMTZBLWSA-N |
| XLogP | 5.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |