C29H29NO4 — CID 177457651
[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,5-diphenylpent-2-ynyl] benzoate (PubChem CID 177457651) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is [5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,5-diphenylpent-2-ynyl] benzoate.
| Compound Name | [5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,5-diphenylpent-2-ynyl] benzoate |
|---|---|
| PubChem CID | 177457651 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | [5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,5-diphenylpent-2-ynyl] benzoate |
| SMILES | CC(C)(C)OC(=O)NC(CC#CC(OC(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29NO4/c1-29(2,3)34-28(32)30-25(22-14-7-4-8-15-22)20-13-21-26(23-16-9-5-10-17-23)33-27(31)24-18-11-6-12-19-24/h4-12,14-19,25-26H,20H2,1-3H3,(H,30,32) |
| InChIKey | JAYJQHCZHQYSJS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|