C13H14Cl3NO5 — CID 11545199
methyl (2R,3S)-2-hydroxy-3-phenyl-3-(2,2,2-trichloroethoxycarbonylamino)propanoate (PubChem CID 11545199) has the molecular formula C13H14Cl3NO5 and a molecular weight of 370.62 g/mol. Its IUPAC name is methyl (2R,3S)-2-hydroxy-3-phenyl-3-(2,2,2-trichloroethoxycarbonylamino)propanoate.
| Compound Name | methyl (2R,3S)-2-hydroxy-3-phenyl-3-(2,2,2-trichloroethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 11545199 |
| Molecular Formula | C13H14Cl3NO5 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | methyl (2R,3S)-2-hydroxy-3-phenyl-3-(2,2,2-trichloroethoxycarbonylamino)propanoate |
| SMILES | COC(=O)[C@H](O)[C@@H](NC(=O)OCC(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C13H14Cl3NO5/c1-21-11(19)10(18)9(8-5-3-2-4-6-8)17-12(20)22-7-13(14,15)16/h2-6,9-10,18H,7H2,1H3,(H,17,20)/t9-,10+/m0/s1 |
| InChIKey | OQXZCZPHGZPHNR-VHSXEESVSA-N |
| XLogP | 2.36 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|