C7H10Cl3NO4 — CID 15658634
methyl (2S)-2-(2,2,2-trichloroethoxycarbonylamino)propanoate (PubChem CID 15658634) has the molecular formula C7H10Cl3NO4 and a molecular weight of 278.52 g/mol. Its IUPAC name is methyl (2S)-2-(2,2,2-trichloroethoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 15658634 |
| Molecular Formula | C7H10Cl3NO4 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | methyl (2S)-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H10Cl3NO4/c1-4(5(12)14-2)11-6(13)15-3-7(8,9)10/h4H,3H2,1-2H3,(H,11,13)/t4-/m0/s1 |
| InChIKey | KOPXNPKLVTYMQI-BYPYZUCNSA-N |
| XLogP | 1.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|