About 2,2,2-trichloroethyl (2S)-2-aminopropanoate
2,2,2-trichloroethyl (2S)-2-aminopropanoate (PubChem CID 10900160) has the molecular formula C5H8Cl3NO2
and a molecular weight of 220.48 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | 2,2,2-trichloroethyl (2S)-2-aminopropanoate |
| PubChem CID | 10900160 |
| Molecular Formula | C5H8Cl3NO2 |
| Molecular Weight | 220.48 g/mol |
| Exact Mass | 218.96 |
| IUPAC Name | 2,2,2-trichloroethyl (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H8Cl3NO2/c1-3(9)4(10)11-2-5(6,7)8/h3H,2,9H2,1H3/t3-/m0/s1 |
| InChIKey | YLKSBHMCFDBNAF-VKHMYHEASA-N |
| XLogP | 1.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloroethyl (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloroethyl (2S)-2-aminopropanoate?
The IUPAC name of 2,2,2-trichloroethyl (2S)-2-aminopropanoate (CID 10900160) is 2,2,2-trichloroethyl (2S)-2-aminopropanoate.
What is the SMILES notation for 2,2,2-trichloroethyl (2S)-2-aminopropanoate?
The canonical SMILES for 2,2,2-trichloroethyl (2S)-2-aminopropanoate is C[C@H](N)C(=O)OCC(Cl)(Cl)Cl.
What is the InChIKey of 2,2,2-trichloroethyl (2S)-2-aminopropanoate?
The InChIKey is YLKSBHMCFDBNAF-VKHMYHEASA-N. The full InChI is InChI=1S/C5H8Cl3NO2/c1-3(9)4(10)11-2-5(6,7)8/h3H,2,9H2,1H3/t3-/m0/s1.
What are the key properties of 2,2,2-trichloroethyl (2S)-2-aminopropanoate?
2,2,2-trichloroethyl (2S)-2-aminopropanoate has a molecular weight of 220.48 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloroethyl (2S)-2-aminopropanoate is sourced from PubChem (CID 10900160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).