C7H9Cl3INO4 — CID 174897548
1-O-methyl 3-O-(2,2,2-trichloroethyl) 2-[amino(iodo)methyl]propanedioate (PubChem CID 174897548) has the molecular formula C7H9Cl3INO4 and a molecular weight of 404.42 g/mol. Its IUPAC name is 1-O-methyl 3-O-(2,2,2-trichloroethyl) 2-[amino(iodo)methyl]propanedioate.
| Compound Name | 1-O-methyl 3-O-(2,2,2-trichloroethyl) 2-[amino(iodo)methyl]propanedioate |
|---|---|
| PubChem CID | 174897548 |
| Molecular Formula | C7H9Cl3INO4 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 402.86 |
| IUPAC Name | 1-O-methyl 3-O-(2,2,2-trichloroethyl) 2-[amino(iodo)methyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OCC(Cl)(Cl)Cl)C(N)I |
| InChI | InChI=1S/C7H9Cl3INO4/c1-15-5(13)3(4(11)12)6(14)16-2-7(8,9)10/h3-4H,2,12H2,1H3 |
| InChIKey | NCTIWCXHJKWSDD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|