C9H11Cl4NO4 — CID 88661603
methyl (Z)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoate (PubChem CID 88661603) has the molecular formula C9H11Cl4NO4 and a molecular weight of 339.00 g/mol. Its IUPAC name is methyl (Z)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoate.
| Compound Name | methyl (Z)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoate |
|---|---|
| PubChem CID | 88661603 |
| Molecular Formula | C9H11Cl4NO4 |
| Molecular Weight | 339.00 g/mol |
| Exact Mass | 336.94 |
| IUPAC Name | methyl (Z)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoate |
| SMILES | COC(=O)C(NC(=O)OCC(Cl)(Cl)Cl)/C(C)=C\Cl |
| InChI | InChI=1S/C9H11Cl4NO4/c1-5(3-10)6(7(15)17-2)14-8(16)18-4-9(11,12)13/h3,6H,4H2,1-2H3,(H,14,16)/b5-3- |
| InChIKey | VLRFTXBXWNFCFV-HYXAFXHYSA-N |
| XLogP | 2.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.00 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|