C16H19Cl4N3O6S — CID 88661785
(2S,5R,6S)-6-[[(Z)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 88661785) has the molecular formula C16H19Cl4N3O6S and a molecular weight of 523.22 g/mol. Its IUPAC name is (2S,5R,6S)-6-[[(Z)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6S)-6-[[(Z)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 88661785 |
| Molecular Formula | C16H19Cl4N3O6S |
| Molecular Weight | 523.22 g/mol |
| Exact Mass | 520.97 |
| IUPAC Name | (2S,5R,6S)-6-[[(Z)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C/C(=C/Cl)C(NC(=O)OCC(Cl)(Cl)Cl)C(=O)N[C@H]1C(=O)N2[C@@H]1SC(C)(C)[C@@H]2C(=O)O |
| InChI | InChI=1S/C16H19Cl4N3O6S/c1-6(4-17)7(22-14(28)29-5-16(18,19)20)10(24)21-8-11(25)23-9(13(26)27)15(2,3)30-12(8)23/h4,7-9,12H,5H2,1-3H3,(H,21,24)(H,22,28)(H,26,27)/b6-4-/t7?,8-,9-,12+/m0/s1 |
| InChIKey | RBZRSXCSBWOYDK-RXBCSRGDSA-N |
| XLogP | 2.23 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|