C16H20Cl3N3O6S — CID 70435139
(2S,5R,6S)-3,3-dimethyl-7-oxo-6-[[(E)-2-(2,2,2-trichloroethoxycarbonylamino)pent-3-enoyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 70435139) has the molecular formula C16H20Cl3N3O6S and a molecular weight of 488.78 g/mol. Its IUPAC name is (2S,5R,6S)-3,3-dimethyl-7-oxo-6-[[(E)-2-(2,2,2-trichloroethoxycarbonylamino)pent-3-enoyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6S)-3,3-dimethyl-7-oxo-6-[[(E)-2-(2,2,2-trichloroethoxycarbonylamino)pent-3-enoyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 70435139 |
| Molecular Formula | C16H20Cl3N3O6S |
| Molecular Weight | 488.78 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | (2S,5R,6S)-3,3-dimethyl-7-oxo-6-[[(E)-2-(2,2,2-trichloroethoxycarbonylamino)pent-3-enoyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C/C=C/C(NC(=O)OCC(Cl)(Cl)Cl)C(=O)N[C@H]1C(=O)N2[C@@H]1SC(C)(C)[C@@H]2C(=O)O |
| InChI | InChI=1S/C16H20Cl3N3O6S/c1-4-5-7(20-14(27)28-6-16(17,18)19)10(23)21-8-11(24)22-9(13(25)26)15(2,3)29-12(8)22/h4-5,7-9,12H,6H2,1-3H3,(H,20,27)(H,21,23)(H,25,26)/b5-4+/t7?,8-,9-,12+/m0/s1 |
| InChIKey | XTDXXABVMONPEY-MWKOHHEYSA-N |
| XLogP | 1.66 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.78 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|