C17H20Cl3NO4 — CID 24867750
methyl (E,5R,6S)-5-methyl-6-phenyl-6-(2,2,2-trichloroethoxycarbonylamino)hex-3-enoate (PubChem CID 24867750) has the molecular formula C17H20Cl3NO4 and a molecular weight of 408.71 g/mol. Its IUPAC name is methyl (E,5R,6S)-5-methyl-6-phenyl-6-(2,2,2-trichloroethoxycarbonylamino)hex-3-enoate.
| Compound Name | methyl (E,5R,6S)-5-methyl-6-phenyl-6-(2,2,2-trichloroethoxycarbonylamino)hex-3-enoate |
|---|---|
| PubChem CID | 24867750 |
| Molecular Formula | C17H20Cl3NO4 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | methyl (E,5R,6S)-5-methyl-6-phenyl-6-(2,2,2-trichloroethoxycarbonylamino)hex-3-enoate |
| SMILES | COC(=O)C/C=C/[C@@H](C)[C@H](NC(=O)OCC(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C17H20Cl3NO4/c1-12(7-6-10-14(22)24-2)15(13-8-4-3-5-9-13)21-16(23)25-11-17(18,19)20/h3-9,12,15H,10-11H2,1-2H3,(H,21,23)/b7-6+/t12-,15+/m1/s1 |
| InChIKey | JXFFSYBLBKAHLO-BQKNJBSGSA-N |
| XLogP | 4.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|