C18H22Cl3NO5 — CID 24867749
methyl (E,5R,6S)-6-(3-methoxyphenyl)-5-methyl-6-(2,2,2-trichloroethoxycarbonylamino)hex-3-enoate (PubChem CID 24867749) has the molecular formula C18H22Cl3NO5 and a molecular weight of 438.74 g/mol. Its IUPAC name is methyl (E,5R,6S)-6-(3-methoxyphenyl)-5-methyl-6-(2,2,2-trichloroethoxycarbonylamino)hex-3-enoate.
| Compound Name | methyl (E,5R,6S)-6-(3-methoxyphenyl)-5-methyl-6-(2,2,2-trichloroethoxycarbonylamino)hex-3-enoate |
|---|---|
| PubChem CID | 24867749 |
| Molecular Formula | C18H22Cl3NO5 |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | methyl (E,5R,6S)-6-(3-methoxyphenyl)-5-methyl-6-(2,2,2-trichloroethoxycarbonylamino)hex-3-enoate |
| SMILES | COC(=O)C/C=C/[C@@H](C)[C@H](NC(=O)OCC(Cl)(Cl)Cl)c1cccc(OC)c1 |
| InChI | InChI=1S/C18H22Cl3NO5/c1-12(6-4-9-15(23)26-3)16(13-7-5-8-14(10-13)25-2)22-17(24)27-11-18(19,20)21/h4-8,10,12,16H,9,11H2,1-3H3,(H,22,24)/b6-4+/t12-,16+/m1/s1 |
| InChIKey | AHCXDMAUANGLKK-QTYSSTRNSA-N |
| XLogP | 4.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|